C15H17ClN4 — CID 111041913
2-[(6-chloro-3-pyridinyl)methyl]-1-(2-phenylethyl)guanidine (PubChem CID 111041913) has the molecular formula C15H17ClN4 and a molecular weight of 288.78 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl]-1-(2-phenylethyl)guanidine.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 111041913 |
| Molecular Formula | C15H17ClN4 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl]-1-(2-phenylethyl)guanidine |
| SMILES | N/C(=N\Cc1ccc(Cl)nc1)NCCc1ccccc1 |
| InChI | InChI=1S/C15H17ClN4/c16-14-7-6-13(10-19-14)11-20-15(17)18-9-8-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2,(H3,17,18,20) |
| InChIKey | QNUNGEGJQZQFJZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|