C18H21F3IN3O — CID 111040842
1-(2-phenylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111040842) has the molecular formula C18H21F3IN3O and a molecular weight of 479.28 g/mol. Its IUPAC name is 1-(2-phenylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-phenylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111040842 |
| Molecular Formula | C18H21F3IN3O |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 1-(2-phenylethyl)-2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCc1ccccc1 |
| InChI | InChI=1S/C18H20F3N3O.HI/c19-18(20,21)13-25-16-8-6-15(7-9-16)12-24-17(22)23-11-10-14-4-2-1-3-5-14;/h1-9H,10-13H2,(H3,22,23,24);1H |
| InChIKey | VJNWKQKABFDZFY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|