C23H27IN4O2 — CID 110925910
1-[2-(4-methoxyphenyl)ethyl]-2-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 110925910) has the molecular formula C23H27IN4O2 and a molecular weight of 518.40 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethyl]-2-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(4-methoxyphenyl)ethyl]-2-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110925910 |
| Molecular Formula | C23H27IN4O2 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethyl]-2-[[4-(pyridin-2-ylmethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(CCN/C(N)=N/Cc2ccc(OCc3ccccn3)cc2)cc1.I |
| InChI | InChI=1S/C23H26N4O2.HI/c1-28-21-9-5-18(6-10-21)13-15-26-23(24)27-16-19-7-11-22(12-8-19)29-17-20-4-2-3-14-25-20;/h2-12,14H,13,15-17H2,1H3,(H3,24,26,27);1H |
| InChIKey | VASKTKONJBWEHG-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|