C19H26N4O3 — CID 111088393
2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111088393) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111088393 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-(2-pyridin-2-ylethyl)guanidine |
| SMILES | CCOc1c(OC)cc(C/N=C(\N)NCCc2ccccn2)cc1OC |
| InChI | InChI=1S/C19H26N4O3/c1-4-26-18-16(24-2)11-14(12-17(18)25-3)13-23-19(20)22-10-8-15-7-5-6-9-21-15/h5-7,9,11-12H,4,8,10,13H2,1-3H3,(H3,20,22,23) |
| InChIKey | ZPUKSJLEBORNBX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|