C17H18F3N3O — CID 78882834
2-benzyl-1-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 78882834) has the molecular formula C17H18F3N3O and a molecular weight of 337.35 g/mol. Its IUPAC name is 2-benzyl-1-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 2-benzyl-1-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 78882834 |
| Molecular Formula | C17H18F3N3O |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-benzyl-1-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccccc1)NCc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H18F3N3O/c18-17(19,20)12-24-15-8-6-14(7-9-15)11-23-16(21)22-10-13-4-2-1-3-5-13/h1-9H,10-12H2,(H3,21,22,23) |
| InChIKey | OPLOFBPJXOSLSW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|