C22H27F3N4O2 — CID 111872705
N-benzyl-3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide (PubChem CID 111872705) has the molecular formula C22H27F3N4O2 and a molecular weight of 436.48 g/mol. Its IUPAC name is N-benzyl-3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-benzyl-3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111872705 |
| Molecular Formula | C22H27F3N4O2 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-benzyl-3-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C22H27F3N4O2/c1-2-26-21(27-13-12-20(30)28-14-17-6-4-3-5-7-17)29-15-18-8-10-19(11-9-18)31-16-22(23,24)25/h3-11H,2,12-16H2,1H3,(H,28,30)(H2,26,27,29) |
| InChIKey | LVJUBBAGDKNGJN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|