C21H25F3N4O2 — CID 111364679
2-[[N'-benzyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide (PubChem CID 111364679) has the molecular formula C21H25F3N4O2 and a molecular weight of 422.45 g/mol. Its IUPAC name is 2-[[N'-benzyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[N'-benzyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111364679 |
| Molecular Formula | C21H25F3N4O2 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 2-[[N'-benzyl-N-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CN/C(=N\Cc1ccccc1)NCc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H25F3N4O2/c1-28(2)19(29)14-27-20(25-12-16-6-4-3-5-7-16)26-13-17-8-10-18(11-9-17)30-15-21(22,23)24/h3-11H,12-15H2,1-2H3,(H2,25,26,27) |
| InChIKey | GUCJVUKJUGMXMU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|