C16H24F3IN4O2 — CID 111365748
2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111365748) has the molecular formula C16H24F3IN4O2 and a molecular weight of 488.29 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111365748 |
| Molecular Formula | C16H24F3IN4O2 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCC(=O)N(C)C.I |
| InChI | InChI=1S/C16H23F3N4O2.HI/c1-4-20-15(22-10-14(24)23(2)3)21-9-12-5-7-13(8-6-12)25-11-16(17,18)19;/h5-8H,4,9-11H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | ZJUVFRWPBCYLKW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|