C17H25F3N4O3 — CID 111871131
2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111871131) has the molecular formula C17H25F3N4O3 and a molecular weight of 390.41 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111871131 |
| Molecular Formula | C17H25F3N4O3 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[[N-ethyl-N'-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN/C(=N\Cc1ccc(OCC(F)(F)F)cc1)NCC(=O)NCCOC |
| InChI | InChI=1S/C17H25F3N4O3/c1-3-21-16(24-11-15(25)22-8-9-26-2)23-10-13-4-6-14(7-5-13)27-12-17(18,19)20/h4-7H,3,8-12H2,1-2H3,(H,22,25)(H2,21,23,24) |
| InChIKey | XHTSCWKPHFSGGZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|