C20H32F3IN4O3 — CID 111694755
2-[[N-ethyl-N'-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111694755) has the molecular formula C20H32F3IN4O3 and a molecular weight of 560.40 g/mol. Its IUPAC name is 2-[[N-ethyl-N'-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N-ethyl-N'-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111694755 |
| Molecular Formula | C20H32F3IN4O3 |
| Molecular Weight | 560.40 g/mol |
| Exact Mass | 560.15 |
| IUPAC Name | 2-[[N-ethyl-N'-[[4-[(2-methylpropan-2-yl)oxy]-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC(C)(C)C)cc1C(F)(F)F)NCC(=O)NCCOC.I |
| InChI | InChI=1S/C20H31F3N4O3.HI/c1-6-24-18(27-13-17(28)25-9-10-29-5)26-12-14-7-8-15(30-19(2,3)4)11-16(14)20(21,22)23;/h7-8,11H,6,9-10,12-13H2,1-5H3,(H,25,28)(H2,24,26,27);1H |
| InChIKey | WVGVRLNZVSXYQS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|