C15H21F4IN4O — CID 111889486
N-ethyl-2-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111889486) has the molecular formula C15H21F4IN4O and a molecular weight of 476.26 g/mol. Its IUPAC name is N-ethyl-2-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-ethyl-2-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111889486 |
| Molecular Formula | C15H21F4IN4O |
| Molecular Weight | 476.26 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | N-ethyl-2-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CCNC(=O)CN/C(=N/Cc1ccc(F)cc1C(F)(F)F)NCC.I |
| InChI | InChI=1S/C15H20F4N4O.HI/c1-3-20-13(24)9-23-14(21-4-2)22-8-10-5-6-11(16)7-12(10)15(17,18)19;/h5-7H,3-4,8-9H2,1-2H3,(H,20,24)(H2,21,22,23);1H |
| InChIKey | MDOUBBZNVZWXLG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|