C17H24F4IN3O2 — CID 111889332
propan-2-yl 3-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanoate;hydroiodide (PubChem CID 111889332) has the molecular formula C17H24F4IN3O2 and a molecular weight of 505.29 g/mol. Its IUPAC name is propan-2-yl 3-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanoate;hydroiodide.
| Compound Name | propan-2-yl 3-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanoate;hydroiodide |
|---|---|
| PubChem CID | 111889332 |
| Molecular Formula | C17H24F4IN3O2 |
| Molecular Weight | 505.29 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | propan-2-yl 3-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCCC(=O)OC(C)C.I |
| InChI | InChI=1S/C17H23F4N3O2.HI/c1-4-22-16(23-8-7-15(25)26-11(2)3)24-10-12-5-6-13(18)9-14(12)17(19,20)21;/h5-6,9,11H,4,7-8,10H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | VCWXENVADHEHET-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|