C17H25F4IN4O — CID 111889596
3-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide (PubChem CID 111889596) has the molecular formula C17H25F4IN4O and a molecular weight of 504.31 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111889596 |
| Molecular Formula | C17H25F4IN4O |
| Molecular Weight | 504.31 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | 3-[[N-ethyl-N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
| SMILES | CCCNC(=O)CCN/C(=N/Cc1ccc(F)cc1C(F)(F)F)NCC.I |
| InChI | InChI=1S/C17H24F4N4O.HI/c1-3-8-23-15(26)7-9-24-16(22-4-2)25-11-12-5-6-13(18)10-14(12)17(19,20)21;/h5-6,10H,3-4,7-9,11H2,1-2H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | NCMCWTVHEJPWAU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|