C15H22F4IN3O2S — CID 111890110
1-ethyl-3-(2-ethylsulfonylethyl)-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111890110) has the molecular formula C15H22F4IN3O2S and a molecular weight of 511.32 g/mol. Its IUPAC name is 1-ethyl-3-(2-ethylsulfonylethyl)-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-ethylsulfonylethyl)-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111890110 |
| Molecular Formula | C15H22F4IN3O2S |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 511.04 |
| IUPAC Name | 1-ethyl-3-(2-ethylsulfonylethyl)-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCCS(=O)(=O)CC.I |
| InChI | InChI=1S/C15H21F4N3O2S.HI/c1-3-20-14(21-7-8-25(23,24)4-2)22-10-11-5-6-12(16)9-13(11)15(17,18)19;/h5-6,9H,3-4,7-8,10H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | WBVNHUINRZBJBL-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|