C16H19F4IN4O2S2 — CID 111889320
1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111889320) has the molecular formula C16H19F4IN4O2S2 and a molecular weight of 566.38 g/mol. Its IUPAC name is 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111889320 |
| Molecular Formula | C16H19F4IN4O2S2 |
| Molecular Weight | 566.38 g/mol |
| Exact Mass | 565.99 |
| IUPAC Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NCc1ccc(S(N)(=O)=O)s1.I |
| InChI | InChI=1S/C16H18F4N4O2S2.HI/c1-2-22-15(24-9-12-5-6-14(27-12)28(21,25)26)23-8-10-3-4-11(17)7-13(10)16(18,19)20;/h3-7H,2,8-9H2,1H3,(H2,21,25,26)(H2,22,23,24);1H |
| InChIKey | CDVAJEBGFITPJE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|