C17H25IN4O2S2 — CID 111635517
1-ethyl-2-[(2-ethylphenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111635517) has the molecular formula C17H25IN4O2S2 and a molecular weight of 508.45 g/mol. Its IUPAC name is 1-ethyl-2-[(2-ethylphenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-ethylphenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111635517 |
| Molecular Formula | C17H25IN4O2S2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.05 |
| IUPAC Name | 1-ethyl-2-[(2-ethylphenyl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CC)NCc1ccc(S(N)(=O)=O)s1.I |
| InChI | InChI=1S/C17H24N4O2S2.HI/c1-3-13-7-5-6-8-14(13)11-20-17(19-4-2)21-12-15-9-10-16(24-15)25(18,22)23;/h5-10H,3-4,11-12H2,1-2H3,(H2,18,22,23)(H2,19,20,21);1H |
| InChIKey | QJZOUVQTIPKOPZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|