C14H18FIN4O2S2 — CID 111264556
1-[(2-fluorophenyl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111264556) has the molecular formula C14H18FIN4O2S2 and a molecular weight of 484.36 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111264556 |
| Molecular Formula | C14H18FIN4O2S2 |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 483.99 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-2-methyl-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)s1)NCc1ccccc1F.I |
| InChI | InChI=1S/C14H17FN4O2S2.HI/c1-17-14(18-8-10-4-2-3-5-12(10)15)19-9-11-6-7-13(22-11)23(16,20)21;/h2-7H,8-9H2,1H3,(H2,16,20,21)(H2,17,18,19);1H |
| InChIKey | RCVPUSAYGUMSNB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|