C16H22N4O2S3 — CID 111676956
2-methyl-1-(2-phenylsulfanylpropyl)-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111676956) has the molecular formula C16H22N4O2S3 and a molecular weight of 398.58 g/mol. Its IUPAC name is 2-methyl-1-(2-phenylsulfanylpropyl)-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-(2-phenylsulfanylpropyl)-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111676956 |
| Molecular Formula | C16H22N4O2S3 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 2-methyl-1-(2-phenylsulfanylpropyl)-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(S(N)(=O)=O)s1)NCC(C)Sc1ccccc1 |
| InChI | InChI=1S/C16H22N4O2S3/c1-12(23-13-6-4-3-5-7-13)10-19-16(18-2)20-11-14-8-9-15(24-14)25(17,21)22/h3-9,12H,10-11H2,1-2H3,(H2,17,21,22)(H2,18,19,20) |
| InChIKey | IGQVWKHDJUASJU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|