C13H18N4O2S3 — CID 111892395
2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine (PubChem CID 111892395) has the molecular formula C13H18N4O2S3 and a molecular weight of 358.51 g/mol. Its IUPAC name is 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111892395 |
| Molecular Formula | C13H18N4O2S3 |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | 2-methyl-1-[(3-methylthiophen-2-yl)methyl]-3-[(5-sulfamoylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(N)(=O)=O)s1)NCc1sccc1C |
| InChI | InChI=1S/C13H18N4O2S3/c1-9-5-6-20-11(9)8-17-13(15-2)16-7-10-3-4-12(21-10)22(14,18)19/h3-6H,7-8H2,1-2H3,(H2,14,18,19)(H2,15,16,17) |
| InChIKey | MKELUNRCHPFAJN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|