C14H18IN3S2 — CID 111893103
1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111893103) has the molecular formula C14H18IN3S2 and a molecular weight of 419.36 g/mol. Its IUPAC name is 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111893103 |
| Molecular Formula | C14H18IN3S2 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.00 |
| IUPAC Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccc(I)s1)NCc1sccc1C |
| InChI | InChI=1S/C14H18IN3S2/c1-10-6-8-19-12(10)9-18-14(16-2)17-7-5-11-3-4-13(15)20-11/h3-4,6,8H,5,7,9H2,1-2H3,(H2,16,17,18) |
| InChIKey | RZILIYZPXJKBQC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|