C15H23I2N5S — CID 111951738
1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111951738) has the molecular formula C15H23I2N5S and a molecular weight of 559.26 g/mol. Its IUPAC name is 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111951738 |
| Molecular Formula | C15H23I2N5S |
| Molecular Weight | 559.26 g/mol |
| Exact Mass | 558.98 |
| IUPAC Name | 1-[2-(5-iodothiophen-2-yl)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccc(I)s1)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C15H22IN5S.HI/c1-10-13(11(2)21(4)20-10)9-19-15(17-3)18-8-7-12-5-6-14(16)22-12;/h5-6H,7-9H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | VDEJSNBXVQCDQC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.26 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|