C15H23N5O — CID 111785707
1-[2-(furan-2-yl)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine (PubChem CID 111785707) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111785707 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-methyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCCc1ccco1)NCc1c(C)nn(C)c1C |
| InChI | InChI=1S/C15H23N5O/c1-11-14(12(2)20(4)19-11)10-18-15(16-3)17-8-7-13-6-5-9-21-13/h5-6,9H,7-8,10H2,1-4H3,(H2,16,17,18) |
| InChIKey | UDYPCZIFRIOMIY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|