C11H20IN3O2S2 — CID 111893752
2-methyl-1-(2-methylsulfonylethyl)-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111893752) has the molecular formula C11H20IN3O2S2 and a molecular weight of 417.34 g/mol. Its IUPAC name is 2-methyl-1-(2-methylsulfonylethyl)-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylsulfonylethyl)-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111893752 |
| Molecular Formula | C11H20IN3O2S2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | 2-methyl-1-(2-methylsulfonylethyl)-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(C)(=O)=O)NCc1sccc1C.I |
| InChI | InChI=1S/C11H19N3O2S2.HI/c1-9-4-6-17-10(9)8-14-11(12-2)13-5-7-18(3,15)16;/h4,6H,5,7-8H2,1-3H3,(H2,12,13,14);1H |
| InChIKey | VTQHFHHHLWKBAK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|