C16H22IN3O2S2 — CID 111893796
1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111893796) has the molecular formula C16H22IN3O2S2 and a molecular weight of 479.41 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111893796 |
| Molecular Formula | C16H22IN3O2S2 |
| Molecular Weight | 479.41 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-[(3-methylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCS(=O)(=O)c1ccccc1)NCc1sccc1C.I |
| InChI | InChI=1S/C16H21N3O2S2.HI/c1-13-8-10-22-15(13)12-19-16(17-2)18-9-11-23(20,21)14-6-4-3-5-7-14;/h3-8,10H,9,11-12H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | SCPIWKZBWNDWAA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|