C18H24IN3O2S2 — CID 111372494
1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111372494) has the molecular formula C18H24IN3O2S2 and a molecular weight of 505.45 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111372494 |
| Molecular Formula | C18H24IN3O2S2 |
| Molecular Weight | 505.45 g/mol |
| Exact Mass | 505.04 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-2-methyl-3-(2-phenylsulfanylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCSc1ccccc1)NCCS(=O)(=O)c1ccccc1.I |
| InChI | InChI=1S/C18H23N3O2S2.HI/c1-19-18(20-12-14-24-16-8-4-2-5-9-16)21-13-15-25(22,23)17-10-6-3-7-11-17;/h2-11H,12-15H2,1H3,(H2,19,20,21);1H |
| InChIKey | ZOXUYGIHCNSZON-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|