C16H27N3O2S2 — CID 111628294
1-[3-(benzenesulfonyl)propyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine (PubChem CID 111628294) has the molecular formula C16H27N3O2S2 and a molecular weight of 357.55 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine |
|---|---|
| PubChem CID | 111628294 |
| Molecular Formula | C16H27N3O2S2 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-2-methyl-3-(4-methylsulfanylbutyl)guanidine |
| SMILES | C/N=C(\NCCCCSC)NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H27N3O2S2/c1-17-16(18-11-6-7-13-22-2)19-12-8-14-23(20,21)15-9-4-3-5-10-15/h3-5,9-10H,6-8,11-14H2,1-2H3,(H2,17,18,19) |
| InChIKey | QDJHHKDHOSPOSJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|