C15H25N3O3S — CID 110974115
1-[3-(benzenesulfonyl)propyl]-3-(3-methoxypropyl)-2-methylguanidine (PubChem CID 110974115) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-(3-methoxypropyl)-2-methylguanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-(3-methoxypropyl)-2-methylguanidine |
|---|---|
| PubChem CID | 110974115 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-(3-methoxypropyl)-2-methylguanidine |
| SMILES | C/N=C(\NCCCOC)NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H25N3O3S/c1-16-15(17-10-6-12-21-2)18-11-7-13-22(19,20)14-8-4-3-5-9-14/h3-5,8-9H,6-7,10-13H2,1-2H3,(H2,16,17,18) |
| InChIKey | LKUMNTMVFQWLDY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|