C17H27N3O2S — CID 110957518
1-[3-(benzenesulfonyl)propyl]-3-cyclohexyl-2-methylguanidine (PubChem CID 110957518) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-3-cyclohexyl-2-methylguanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-3-cyclohexyl-2-methylguanidine |
|---|---|
| PubChem CID | 110957518 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-3-cyclohexyl-2-methylguanidine |
| SMILES | C/N=C(\NCCCS(=O)(=O)c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C17H27N3O2S/c1-18-17(20-15-9-4-2-5-10-15)19-13-8-14-23(21,22)16-11-6-3-7-12-16/h3,6-7,11-12,15H,2,4-5,8-10,13-14H2,1H3,(H2,18,19,20) |
| InChIKey | PYJZCFMURUIKMD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|