C17H25F3N4O2S — CID 111914616
1-[3-(benzenesulfonyl)propyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111914616) has the molecular formula C17H25F3N4O2S and a molecular weight of 406.47 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111914616 |
| Molecular Formula | C17H25F3N4O2S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCCCS(=O)(=O)c1ccccc1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C17H25F3N4O2S/c1-21-16(23-14-8-10-24(12-14)13-17(18,19)20)22-9-5-11-27(25,26)15-6-3-2-4-7-15/h2-4,6-7,14H,5,8-13H2,1H3,(H2,21,22,23) |
| InChIKey | UAJDJXQHACLALP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|