C17H26F3N5O2S — CID 111914162
1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111914162) has the molecular formula C17H26F3N5O2S and a molecular weight of 421.49 g/mol. Its IUPAC name is 1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111914162 |
| Molecular Formula | C17H26F3N5O2S |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-[2-(benzylsulfamoyl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCCS(=O)(=O)NCc1ccccc1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C17H26F3N5O2S/c1-21-16(24-15-7-9-25(12-15)13-17(18,19)20)22-8-10-28(26,27)23-11-14-5-3-2-4-6-14/h2-6,15,23H,7-13H2,1H3,(H2,21,22,24) |
| InChIKey | PRNIRULSNROJBD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|