C18H27F3IN5O — CID 111916094
N-benzyl-3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111916094) has the molecular formula C18H27F3IN5O and a molecular weight of 513.35 g/mol. Its IUPAC name is N-benzyl-3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N-benzyl-3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111916094 |
| Molecular Formula | C18H27F3IN5O |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | N-benzyl-3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | C/N=C(\NCCC(=O)NCc1ccccc1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C18H26F3N5O.HI/c1-22-17(25-15-8-10-26(12-15)13-18(19,20)21)23-9-7-16(27)24-11-14-5-3-2-4-6-14;/h2-6,15H,7-13H2,1H3,(H,24,27)(H2,22,23,25);1H |
| InChIKey | MUVAVUSANZCIMV-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|