C12H21F3N4O2 — CID 111915813
methyl 3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]propanoate (PubChem CID 111915813) has the molecular formula C12H21F3N4O2 and a molecular weight of 310.32 g/mol. Its IUPAC name is methyl 3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]propanoate.
| Compound Name | methyl 3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]propanoate |
|---|---|
| PubChem CID | 111915813 |
| Molecular Formula | C12H21F3N4O2 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | methyl 3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]propanoate |
| SMILES | C/N=C(\NCCC(=O)OC)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C12H21F3N4O2/c1-16-11(17-5-3-10(20)21-2)18-9-4-6-19(7-9)8-12(13,14)15/h9H,3-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | CVEXMLBSONHLBC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|