C14H25F3N4O2 — CID 111913888
ethyl 4-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]butanoate (PubChem CID 111913888) has the molecular formula C14H25F3N4O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is ethyl 4-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]butanoate.
| Compound Name | ethyl 4-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 111913888 |
| Molecular Formula | C14H25F3N4O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | ethyl 4-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]butanoate |
| SMILES | CCOC(=O)CCCN/C(=N\C)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H25F3N4O2/c1-3-23-12(22)5-4-7-19-13(18-2)20-11-6-8-21(9-11)10-14(15,16)17/h11H,3-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | QTMBUJGIDNKYSW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|