C14H26F3N5O — CID 111914156
3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]-N-propan-2-ylpropanamide (PubChem CID 111914156) has the molecular formula C14H26F3N5O and a molecular weight of 337.39 g/mol. Its IUPAC name is 3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 111914156 |
| Molecular Formula | C14H26F3N5O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 3-[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]-N-propan-2-ylpropanamide |
| SMILES | C/N=C(\NCCC(=O)NC(C)C)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C14H26F3N5O/c1-10(2)20-12(23)4-6-19-13(18-3)21-11-5-7-22(8-11)9-14(15,16)17/h10-11H,4-9H2,1-3H3,(H,20,23)(H2,18,19,21) |
| InChIKey | WJHHRZYMJZOFGE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|