C15H30F3N5 — CID 111913848
1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111913848) has the molecular formula C15H30F3N5 and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111913848 |
| Molecular Formula | C15H30F3N5 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 1-[2-[butan-2-yl(methyl)amino]ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCC(C)N(C)CCN/C(=N\C)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C15H30F3N5/c1-5-12(2)22(4)9-7-20-14(19-3)21-13-6-8-23(10-13)11-15(16,17)18/h12-13H,5-11H2,1-4H3,(H2,19,20,21) |
| InChIKey | WKGFKGCOPACLLI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|