C16H29F3N6O — CID 111914296
1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111914296) has the molecular formula C16H29F3N6O and a molecular weight of 378.44 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111914296 |
| Molecular Formula | C16H29F3N6O |
| Molecular Weight | 378.44 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCCN1CCN(C(C)=O)CC1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H29F3N6O/c1-13(26)25-9-7-23(8-10-25)6-4-21-15(20-2)22-14-3-5-24(11-14)12-16(17,18)19/h14H,3-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | XDNMDDBYFXKGCQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.44 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|