C13H24F3N5O — CID 109473413
1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473413) has the molecular formula C13H24F3N5O and a molecular weight of 323.36 g/mol. Its IUPAC name is 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473413 |
| Molecular Formula | C13H24F3N5O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 1-[2-(4-acetylpiperazin-1-yl)ethyl]-2-methyl-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(/NCCN1CCN(C(C)=O)CC1)NCCC(F)(F)F |
| InChI | InChI=1S/C13H24F3N5O/c1-11(22)21-9-7-20(8-10-21)6-5-19-12(17-2)18-4-3-13(14,15)16/h3-10H2,1-2H3,(H2,17,18,19) |
| InChIKey | NGSKPPWFVPUSCR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|