C13H26F3N5 — CID 109474063
2-methyl-1-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109474063) has the molecular formula C13H26F3N5 and a molecular weight of 309.38 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109474063 |
| Molecular Formula | C13H26F3N5 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 2-methyl-1-[2-(4-methyl-1,4-diazepan-1-yl)ethyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(/NCCN1CCCN(C)CC1)NCCC(F)(F)F |
| InChI | InChI=1S/C13H26F3N5/c1-17-12(18-5-4-13(14,15)16)19-6-9-21-8-3-7-20(2)10-11-21/h3-11H2,1-2H3,(H2,17,18,19) |
| InChIKey | DXIVREGHCUFJIE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|