C14H27F3IN5O — CID 111085566
2-methyl-1-(2-morpholin-4-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111085566) has the molecular formula C14H27F3IN5O and a molecular weight of 465.30 g/mol. Its IUPAC name is 2-methyl-1-(2-morpholin-4-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-morpholin-4-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111085566 |
| Molecular Formula | C14H27F3IN5O |
| Molecular Weight | 465.30 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-methyl-1-(2-morpholin-4-ylethyl)-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN1CCOCC1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C14H26F3N5O.HI/c1-18-13(19-3-5-21-6-8-23-9-7-21)20-12-2-4-22(10-12)11-14(15,16)17;/h12H,2-11H2,1H3,(H2,18,19,20);1H |
| InChIKey | OEMILVIFQLQFHC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 52.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|