C21H26F3N5O — CID 111915002
2-methyl-1-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915002) has the molecular formula C21H26F3N5O and a molecular weight of 421.47 g/mol. Its IUPAC name is 2-methyl-1-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-methyl-1-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915002 |
| Molecular Formula | C21H26F3N5O |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-methyl-1-[[4-[(2-oxo-1-pyridinyl)methyl]phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCc1ccc(Cn2ccccc2=O)cc1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C21H26F3N5O/c1-25-20(27-18-9-11-28(14-18)15-21(22,23)24)26-12-16-5-7-17(8-6-16)13-29-10-3-2-4-19(29)30/h2-8,10,18H,9,11-15H2,1H3,(H2,25,26,27) |
| InChIKey | XHDDNAXNRCNORU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|