C20H27F3N6 — CID 111913952
2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111913952) has the molecular formula C20H27F3N6 and a molecular weight of 408.47 g/mol. Its IUPAC name is 2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111913952 |
| Molecular Formula | C20H27F3N6 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-methyl-1-[[3-[(2-methylimidazol-1-yl)methyl]phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCc1cccc(Cn2ccnc2C)c1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C20H27F3N6/c1-15-25-7-9-29(15)12-17-5-3-4-16(10-17)11-26-19(24-2)27-18-6-8-28(13-18)14-20(21,22)23/h3-5,7,9-10,18H,6,8,11-14H2,1-2H3,(H2,24,26,27) |
| InChIKey | FHHAKNQMSHZRFP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|