C16H21F5N4O — CID 111915521
1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915521) has the molecular formula C16H21F5N4O and a molecular weight of 380.36 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915521 |
| Molecular Formula | C16H21F5N4O |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-2-methyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCc1cccc(OC(F)F)c1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H21F5N4O/c1-22-15(24-12-5-6-25(9-12)10-16(19,20)21)23-8-11-3-2-4-13(7-11)26-14(17)18/h2-4,7,12,14H,5-6,8-10H2,1H3,(H2,22,23,24) |
| InChIKey | UREAGGOAVIYXJG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|