C20H25F3IN5O2 — CID 111914517
N-[3-[[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111914517) has the molecular formula C20H25F3IN5O2 and a molecular weight of 551.35 g/mol. Its IUPAC name is N-[3-[[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111914517 |
| Molecular Formula | C20H25F3IN5O2 |
| Molecular Weight | 551.35 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | N-[3-[[[N'-methyl-N-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(NC(=O)c2ccco2)c1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C20H24F3N5O2.HI/c1-24-19(27-16-7-8-28(12-16)13-20(21,22)23)25-11-14-4-2-5-15(10-14)26-18(29)17-6-3-9-30-17;/h2-6,9-10,16H,7-8,11-13H2,1H3,(H,26,29)(H2,24,25,27);1H |
| InChIKey | HXQVWMHTBKJQRQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|