C18H24F3N7 — CID 111913956
2-methyl-1-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111913956) has the molecular formula C18H24F3N7 and a molecular weight of 395.43 g/mol. Its IUPAC name is 2-methyl-1-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-methyl-1-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111913956 |
| Molecular Formula | C18H24F3N7 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 2-methyl-1-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | C/N=C(\NCc1cccc(Cn2cncn2)c1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C18H24F3N7/c1-22-17(26-16-5-6-27(10-16)11-18(19,20)21)24-8-14-3-2-4-15(7-14)9-28-13-23-12-25-28/h2-4,7,12-13,16H,5-6,8-11H2,1H3,(H2,22,24,26) |
| InChIKey | YAMXVJFWMLBKDQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|