C15H19F3N6 — CID 109473379
2-methyl-1-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 109473379) has the molecular formula C15H19F3N6 and a molecular weight of 340.35 g/mol. Its IUPAC name is 2-methyl-1-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 109473379 |
| Molecular Formula | C15H19F3N6 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-methyl-1-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NCc1cccc(Cn2cncn2)c1 |
| InChI | InChI=1S/C15H19F3N6/c1-19-14(21-6-5-15(16,17)18)22-8-12-3-2-4-13(7-12)9-24-11-20-10-23-24/h2-4,7,10-11H,5-6,8-9H2,1H3,(H2,19,21,22) |
| InChIKey | CBPRGHCXJFSSOP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|