C18H25N9 — CID 111701443
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine (PubChem CID 111701443) has the molecular formula C18H25N9 and a molecular weight of 367.46 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111701443 |
| Molecular Formula | C18H25N9 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[3-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]guanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1cccc(Cn2cncn2)c1 |
| InChI | InChI=1S/C18H25N9/c1-3-17-25-23-14-26(17)8-7-21-18(19-2)22-10-15-5-4-6-16(9-15)11-27-13-20-12-24-27/h4-6,9,12-14H,3,7-8,10-11H2,1-2H3,(H2,19,21,22) |
| InChIKey | LYMFKKKQAHLVEW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|