C20H28N8O — CID 111700957
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111700957) has the molecular formula C20H28N8O and a molecular weight of 396.50 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111700957 |
| Molecular Formula | C20H28N8O |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methyl-3-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine |
| SMILES | CCCc1noc(-c2cccc(CN/C(=N/C)NCCn3cnnc3CC)c2)n1 |
| InChI | InChI=1S/C20H28N8O/c1-4-7-17-25-19(29-27-17)16-9-6-8-15(12-16)13-23-20(21-3)22-10-11-28-14-24-26-18(28)5-2/h6,8-9,12,14H,4-5,7,10-11,13H2,1-3H3,(H2,21,22,23) |
| InChIKey | CDCXXERFQCUNNK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 106.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|