C21H28N6O2 — CID 111587225
2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine (PubChem CID 111587225) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine.
| Compound Name | 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111587225 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 2-methyl-1-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]-3-[[3-(3-propyl-1,2,4-oxadiazol-5-yl)phenyl]methyl]guanidine |
| SMILES | CCCc1noc(-c2cccc(CN/C(=N/C)NCc3cc(C(C)C)no3)c2)n1 |
| InChI | InChI=1S/C21H28N6O2/c1-5-7-19-25-20(29-27-19)16-9-6-8-15(10-16)12-23-21(22-4)24-13-17-11-18(14(2)3)26-28-17/h6,8-11,14H,5,7,12-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | JQFFKUCTNNFGOE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|