C16H21N7 — CID 111699839
1-[(3-cyanophenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 111699839) has the molecular formula C16H21N7 and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[(3-cyanophenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111699839 |
| Molecular Formula | C16H21N7 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1cccc(C#N)c1 |
| InChI | InChI=1S/C16H21N7/c1-3-15-22-21-12-23(15)8-7-19-16(18-2)20-11-14-6-4-5-13(9-14)10-17/h4-6,9,12H,3,7-8,11H2,1-2H3,(H2,18,19,20) |
| InChIKey | SRDGKQWMGDBLSG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 90.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|