C15H21BrFIN6 — CID 111700074
1-[(4-bromo-3-fluorophenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 111700074) has the molecular formula C15H21BrFIN6 and a molecular weight of 511.18 g/mol. Its IUPAC name is 1-[(4-bromo-3-fluorophenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4-bromo-3-fluorophenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111700074 |
| Molecular Formula | C15H21BrFIN6 |
| Molecular Weight | 511.18 g/mol |
| Exact Mass | 510.00 |
| IUPAC Name | 1-[(4-bromo-3-fluorophenyl)methyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)NCc1ccc(Br)c(F)c1.I |
| InChI | InChI=1S/C15H20BrFN6.HI/c1-3-14-22-21-10-23(14)7-6-19-15(18-2)20-9-11-4-5-12(16)13(17)8-11;/h4-5,8,10H,3,6-7,9H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | SWJIZVHQVFCOBE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|